C10H18F3N2O4+ — CID 7372638
[(2S)-2-acetamido-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]-(2-methoxyethyl)azanium (PubChem CID 7372638) has the molecular formula C10H18F3N2O4+ and a molecular weight of 287.26 g/mol. Its IUPAC name is [(2S)-2-acetamido-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]-(2-methoxyethyl)azanium.
| Compound Name | [(2S)-2-acetamido-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7372638 |
| Molecular Formula | C10H18F3N2O4+ |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | [(2S)-2-acetamido-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]-(2-methoxyethyl)azanium |
| SMILES | CCOC(=O)[C@](NC(C)=O)([NH2+]CCOC)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O4/c1-4-19-8(17)9(10(11,12)13,15-7(2)16)14-5-6-18-3/h14H,4-6H2,1-3H3,(H,15,16)/p+1/t9-/m1/s1 |
| InChIKey | VVRDOEMRNPNCKJ-SECBINFHSA-O |
| XLogP | -0.85 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|