C9H14F3NO4 — CID 2781153
ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 2781153) has the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. Its IUPAC name is ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 2781153 |
| Molecular Formula | C9H14F3NO4 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCCC(=O)NC(O)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO4/c1-3-5-6(14)13-8(16,9(10,11)12)7(15)17-4-2/h16H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | SRWJCYPEXYCHCF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|