C8H11ClF3NO3 — CID 545806
ethyl 2-chloro-3,3,3-trifluoro-2-(propanoylamino)propanoate (PubChem CID 545806) has the molecular formula C8H11ClF3NO3 and a molecular weight of 261.63 g/mol. Its IUPAC name is ethyl 2-chloro-3,3,3-trifluoro-2-(propanoylamino)propanoate.
| Compound Name | ethyl 2-chloro-3,3,3-trifluoro-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 545806 |
| Molecular Formula | C8H11ClF3NO3 |
| Molecular Weight | 261.63 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | ethyl 2-chloro-3,3,3-trifluoro-2-(propanoylamino)propanoate |
| SMILES | CCOC(=O)C(Cl)(NC(=O)CC)C(F)(F)F |
| InChI | InChI=1S/C8H11ClF3NO3/c1-3-5(14)13-7(9,8(10,11)12)6(15)16-4-2/h3-4H2,1-2H3,(H,13,14) |
| InChIKey | UANLQRANUGPALE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.63 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|