C12H9ClF5NO3 — CID 2781186
ethyl 2-chloro-2-[(2,6-difluorobenzoyl)amino]-3,3,3-trifluoropropanoate (PubChem CID 2781186) has the molecular formula C12H9ClF5NO3 and a molecular weight of 345.65 g/mol. Its IUPAC name is ethyl 2-chloro-2-[(2,6-difluorobenzoyl)amino]-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-chloro-2-[(2,6-difluorobenzoyl)amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 2781186 |
| Molecular Formula | C12H9ClF5NO3 |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | ethyl 2-chloro-2-[(2,6-difluorobenzoyl)amino]-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(Cl)(NC(=O)c1c(F)cccc1F)C(F)(F)F |
| InChI | InChI=1S/C12H9ClF5NO3/c1-2-22-10(21)11(13,12(16,17)18)19-9(20)8-6(14)4-3-5-7(8)15/h3-5H,2H2,1H3,(H,19,20) |
| InChIKey | BYMHMKQKKMCNJM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|