C19H16F5NO4 — CID 3799337
ethyl 2-[(2,6-difluorobenzoyl)amino]-3,3,3-trifluoro-2-phenylmethoxypropanoate (PubChem CID 3799337) has the molecular formula C19H16F5NO4 and a molecular weight of 417.33 g/mol. Its IUPAC name is ethyl 2-[(2,6-difluorobenzoyl)amino]-3,3,3-trifluoro-2-phenylmethoxypropanoate.
| Compound Name | ethyl 2-[(2,6-difluorobenzoyl)amino]-3,3,3-trifluoro-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 3799337 |
| Molecular Formula | C19H16F5NO4 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | ethyl 2-[(2,6-difluorobenzoyl)amino]-3,3,3-trifluoro-2-phenylmethoxypropanoate |
| SMILES | CCOC(=O)C(NC(=O)c1c(F)cccc1F)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H16F5NO4/c1-2-28-17(27)18(19(22,23)24,29-11-12-7-4-3-5-8-12)25-16(26)15-13(20)9-6-10-14(15)21/h3-10H,2,11H2,1H3,(H,25,26) |
| InChIKey | CKVWFQKGXAORRC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|