C19H20F3NO5S — CID 3567506
ethyl 3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]-2-phenylmethoxypropanoate (PubChem CID 3567506) has the molecular formula C19H20F3NO5S and a molecular weight of 431.43 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]-2-phenylmethoxypropanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 3567506 |
| Molecular Formula | C19H20F3NO5S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]-2-phenylmethoxypropanoate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H20F3NO5S/c1-3-27-17(24)18(19(20,21)22,28-13-15-7-5-4-6-8-15)23-29(25,26)16-11-9-14(2)10-12-16/h4-12,23H,3,13H2,1-2H3 |
| InChIKey | CCJJHBDBLWDREQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|