C16H23F3NO9PS — CID 91872802
ethyl 2-bis(ethylperoxy)phosphoryl-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 91872802) has the molecular formula C16H23F3NO9PS and a molecular weight of 493.39 g/mol. Its IUPAC name is ethyl 2-bis(ethylperoxy)phosphoryl-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | ethyl 2-bis(ethylperoxy)phosphoryl-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 91872802 |
| Molecular Formula | C16H23F3NO9PS |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | ethyl 2-bis(ethylperoxy)phosphoryl-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | CCOOP(=O)(OOCC)C(NS(=O)(=O)c1ccc(C)cc1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C16H23F3NO9PS/c1-5-25-14(21)15(16(17,18)19,30(22,28-26-6-2)29-27-7-3)20-31(23,24)13-10-8-12(4)9-11-13/h8-11,20H,5-7H2,1-4H3 |
| InChIKey | TVAMVHYFEHYFNR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|