C17H25F3NO7PS — CID 28887754
methyl (2R)-2-di(propan-2-yloxy)phosphoryl-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 28887754) has the molecular formula C17H25F3NO7PS and a molecular weight of 475.42 g/mol. Its IUPAC name is methyl (2R)-2-di(propan-2-yloxy)phosphoryl-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2R)-2-di(propan-2-yloxy)phosphoryl-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 28887754 |
| Molecular Formula | C17H25F3NO7PS |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | methyl (2R)-2-di(propan-2-yloxy)phosphoryl-3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@](NS(=O)(=O)c1ccc(C)cc1)(C(F)(F)F)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C17H25F3NO7PS/c1-11(2)27-29(23,28-12(3)4)16(15(22)26-6,17(18,19)20)21-30(24,25)14-9-7-13(5)8-10-14/h7-12,21H,1-6H3/t16-/m1/s1 |
| InChIKey | PEIZIBNZWUWKPI-MRXNPFEDSA-N |
| XLogP | 3.75 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|