C12H15IO4S — CID 14112888
methyl 2-iodo-2-methyl-3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 14112888) has the molecular formula C12H15IO4S and a molecular weight of 382.22 g/mol. Its IUPAC name is methyl 2-iodo-2-methyl-3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | methyl 2-iodo-2-methyl-3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 14112888 |
| Molecular Formula | C12H15IO4S |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | methyl 2-iodo-2-methyl-3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | COC(=O)C(C)(I)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H15IO4S/c1-9-4-6-10(7-5-9)18(15,16)8-12(2,13)11(14)17-3/h4-7H,8H2,1-3H3 |
| InChIKey | YJOVNWYFKQKOHX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|