C28H34O8S3 — CID 19936239
1-[2-(methoxymethoxymethyl)-3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfonyl-4-methylbenzene (PubChem CID 19936239) has the molecular formula C28H34O8S3 and a molecular weight of 594.77 g/mol. Its IUPAC name is 1-[2-(methoxymethoxymethyl)-3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[2-(methoxymethoxymethyl)-3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 19936239 |
| Molecular Formula | C28H34O8S3 |
| Molecular Weight | 594.77 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 1-[2-(methoxymethoxymethyl)-3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfonyl-4-methylbenzene |
| SMILES | COCOCC(CS(=O)(=O)c1ccc(C)cc1)(CS(=O)(=O)c1ccc(C)cc1)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H34O8S3/c1-22-5-11-25(12-6-22)37(29,30)18-28(17-36-21-35-4,19-38(31,32)26-13-7-23(2)8-14-26)20-39(33,34)27-15-9-24(3)10-16-27/h5-16H,17-21H2,1-4H3 |
| InChIKey | GSKSHAIGNRMBTB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|