C18H25F3NO6P — CID 7037347
ethyl (2R)-2-benzamido-2-di(propan-2-yloxy)phosphoryl-3,3,3-trifluoropropanoate (PubChem CID 7037347) has the molecular formula C18H25F3NO6P and a molecular weight of 439.37 g/mol. Its IUPAC name is ethyl (2R)-2-benzamido-2-di(propan-2-yloxy)phosphoryl-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2R)-2-benzamido-2-di(propan-2-yloxy)phosphoryl-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 7037347 |
| Molecular Formula | C18H25F3NO6P |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | ethyl (2R)-2-benzamido-2-di(propan-2-yloxy)phosphoryl-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)[C@](NC(=O)c1ccccc1)(C(F)(F)F)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C18H25F3NO6P/c1-6-26-16(24)17(18(19,20)21,22-15(23)14-10-8-7-9-11-14)29(25,27-12(2)3)28-13(4)5/h7-13H,6H2,1-5H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | WKBPDIXAEJFDAX-QGZVFWFLSA-N |
| XLogP | 4.28 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|