C14H18F3NO4S — CID 5248244
ethyl 2-[(4-methylphenyl)sulfonylamino]-2-(trifluoromethyl)butanoate (PubChem CID 5248244) has the molecular formula C14H18F3NO4S and a molecular weight of 353.36 g/mol. Its IUPAC name is ethyl 2-[(4-methylphenyl)sulfonylamino]-2-(trifluoromethyl)butanoate.
| Compound Name | ethyl 2-[(4-methylphenyl)sulfonylamino]-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 5248244 |
| Molecular Formula | C14H18F3NO4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | ethyl 2-[(4-methylphenyl)sulfonylamino]-2-(trifluoromethyl)butanoate |
| SMILES | CCOC(=O)C(CC)(NS(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO4S/c1-4-13(14(15,16)17,12(19)22-5-2)18-23(20,21)11-8-6-10(3)7-9-11/h6-9,18H,4-5H2,1-3H3 |
| InChIKey | DZYPUKHAZVQEFR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |