C22H25NO5S — CID 134949166
ethyl (2R)-3-methylidene-2-[(4-methylphenyl)sulfonylamino]-4-oxo-2-phenylhexanoate (PubChem CID 134949166) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is ethyl (2R)-3-methylidene-2-[(4-methylphenyl)sulfonylamino]-4-oxo-2-phenylhexanoate.
| Compound Name | ethyl (2R)-3-methylidene-2-[(4-methylphenyl)sulfonylamino]-4-oxo-2-phenylhexanoate |
|---|---|
| PubChem CID | 134949166 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | ethyl (2R)-3-methylidene-2-[(4-methylphenyl)sulfonylamino]-4-oxo-2-phenylhexanoate |
| SMILES | C=C(C(=O)CC)[C@@](NS(=O)(=O)c1ccc(C)cc1)(C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C22H25NO5S/c1-5-20(24)17(4)22(21(25)28-6-2,18-10-8-7-9-11-18)23-29(26,27)19-14-12-16(3)13-15-19/h7-15,23H,4-6H2,1-3H3/t22-/m0/s1 |
| InChIKey | HWMKXRRETGLPBG-QFIPXVFZSA-N |
| XLogP | 3.27 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|