C25H25NO4S — CID 101398756
methyl (E)-2-[(4-methylphenyl)sulfonylamino]-2,5-diphenylpent-4-enoate (PubChem CID 101398756) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is methyl (E)-2-[(4-methylphenyl)sulfonylamino]-2,5-diphenylpent-4-enoate.
| Compound Name | methyl (E)-2-[(4-methylphenyl)sulfonylamino]-2,5-diphenylpent-4-enoate |
|---|---|
| PubChem CID | 101398756 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | methyl (E)-2-[(4-methylphenyl)sulfonylamino]-2,5-diphenylpent-4-enoate |
| SMILES | COC(=O)C(C/C=C/c1ccccc1)(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO4S/c1-20-15-17-23(18-16-20)31(28,29)26-25(24(27)30-2,22-13-7-4-8-14-22)19-9-12-21-10-5-3-6-11-21/h3-18,26H,19H2,1-2H3/b12-9+ |
| InChIKey | XNNPYYBPFHWWJA-FMIVXFBMSA-N |
| XLogP | 4.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |