C23H20N2O2S — CID 11954463
N-[(E)-1-cyano-1,3-diphenylprop-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 11954463) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[(E)-1-cyano-1,3-diphenylprop-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-1-cyano-1,3-diphenylprop-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11954463 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[(E)-1-cyano-1,3-diphenylprop-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C#N)(/C=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O2S/c1-19-12-14-22(15-13-19)28(26,27)25-23(18-24,21-10-6-3-7-11-21)17-16-20-8-4-2-5-9-20/h2-17,25H,1H3/b17-16+ |
| InChIKey | INFVQFKTDQEVKP-WUKNDPDISA-N |
| XLogP | 4.41 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |