C28H29NO2SSi — CID 102294028
N-[[dimethyl(phenyl)silyl]-diphenylmethyl]-4-methylbenzenesulfonamide (PubChem CID 102294028) has the molecular formula C28H29NO2SSi and a molecular weight of 471.70 g/mol. Its IUPAC name is N-[[dimethyl(phenyl)silyl]-diphenylmethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[dimethyl(phenyl)silyl]-diphenylmethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102294028 |
| Molecular Formula | C28H29NO2SSi |
| Molecular Weight | 471.70 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[[dimethyl(phenyl)silyl]-diphenylmethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2ccccc2)(c2ccccc2)[Si](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29NO2SSi/c1-23-19-21-26(22-20-23)32(30,31)29-28(24-13-7-4-8-14-24,25-15-9-5-10-16-25)33(2,3)27-17-11-6-12-18-27/h4-22,29H,1-3H3 |
| InChIKey | OXNSPXSXQZCRNS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|