C18H25NO2SSi — CID 164685920
N-[1-[dimethyl(phenyl)silyl]propyl]-4-methylbenzenesulfonamide (PubChem CID 164685920) has the molecular formula C18H25NO2SSi and a molecular weight of 347.56 g/mol. Its IUPAC name is N-[1-[dimethyl(phenyl)silyl]propyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-[dimethyl(phenyl)silyl]propyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164685920 |
| Molecular Formula | C18H25NO2SSi |
| Molecular Weight | 347.56 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[1-[dimethyl(phenyl)silyl]propyl]-4-methylbenzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(C)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H25NO2SSi/c1-5-18(23(3,4)17-9-7-6-8-10-17)19-22(20,21)16-13-11-15(2)12-14-16/h6-14,18-19H,5H2,1-4H3 |
| InChIKey | FDOXBMJFIMOYRI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|