C13H19NO3S — CID 102085271
4-methyl-N-[(2R,3S)-2-methyl-1-oxopentan-3-yl]benzenesulfonamide (PubChem CID 102085271) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-methyl-N-[(2R,3S)-2-methyl-1-oxopentan-3-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2R,3S)-2-methyl-1-oxopentan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 102085271 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-methyl-N-[(2R,3S)-2-methyl-1-oxopentan-3-yl]benzenesulfonamide |
| SMILES | CC[C@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](C)C=O |
| InChI | InChI=1S/C13H19NO3S/c1-4-13(11(3)9-15)14-18(16,17)12-7-5-10(2)6-8-12/h5-9,11,13-14H,4H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | FYGKAPDHVAALGW-AAEUAGOBSA-N |
| XLogP | 1.89 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|