C19H25NO4S2 — CID 71762025
4-methyl-N-[2-methyl-1-(4-methylphenyl)sulfonylbutyl]benzenesulfonamide (PubChem CID 71762025) has the molecular formula C19H25NO4S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-methyl-N-[2-methyl-1-(4-methylphenyl)sulfonylbutyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-methyl-1-(4-methylphenyl)sulfonylbutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71762025 |
| Molecular Formula | C19H25NO4S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-methyl-N-[2-methyl-1-(4-methylphenyl)sulfonylbutyl]benzenesulfonamide |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H25NO4S2/c1-5-16(4)19(25(21,22)17-10-6-14(2)7-11-17)20-26(23,24)18-12-8-15(3)9-13-18/h6-13,16,19-20H,5H2,1-4H3 |
| InChIKey | PHDNIJDSINOFBO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |