C21H29NO2SSi — CID 15418146
N-[(2S,4S)-4-[dimethyl(phenyl)silyl]hex-5-en-2-yl]-4-methylbenzenesulfonamide (PubChem CID 15418146) has the molecular formula C21H29NO2SSi and a molecular weight of 387.62 g/mol. Its IUPAC name is N-[(2S,4S)-4-[dimethyl(phenyl)silyl]hex-5-en-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S,4S)-4-[dimethyl(phenyl)silyl]hex-5-en-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 15418146 |
| Molecular Formula | C21H29NO2SSi |
| Molecular Weight | 387.62 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[(2S,4S)-4-[dimethyl(phenyl)silyl]hex-5-en-2-yl]-4-methylbenzenesulfonamide |
| SMILES | C=C[C@H](C[C@H](C)NS(=O)(=O)c1ccc(C)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H29NO2SSi/c1-6-20(26(4,5)21-10-8-7-9-11-21)16-18(3)22-25(23,24)19-14-12-17(2)13-15-19/h6-15,18,20,22H,1,16H2,2-5H3/t18-,20+/m0/s1 |
| InChIKey | RKQNWTPVYMGWTI-AZUAARDMSA-N |
| XLogP | 4.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|