C22H25NO2SSi — CID 132990503
N-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]-4-methylbenzenesulfonamide (PubChem CID 132990503) has the molecular formula C22H25NO2SSi and a molecular weight of 395.60 g/mol. Its IUPAC name is N-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 132990503 |
| Molecular Formula | C22H25NO2SSi |
| Molecular Weight | 395.60 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[(R)-[dimethyl(phenyl)silyl]-phenylmethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](c2ccccc2)[Si](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25NO2SSi/c1-18-14-16-20(17-15-18)26(24,25)23-22(19-10-6-4-7-11-19)27(2,3)21-12-8-5-9-13-21/h4-17,22-23H,1-3H3/t22-/m1/s1 |
| InChIKey | HZXHHQCUYCTPOR-JOCHJYFZSA-N |
| XLogP | 4.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|