C23H27NO3SSi — CID 135061696
N-[[dimethyl(phenyl)silyl]-(2-methoxyphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 135061696) has the molecular formula C23H27NO3SSi and a molecular weight of 425.63 g/mol. Its IUPAC name is N-[[dimethyl(phenyl)silyl]-(2-methoxyphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[dimethyl(phenyl)silyl]-(2-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135061696 |
| Molecular Formula | C23H27NO3SSi |
| Molecular Weight | 425.63 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[[dimethyl(phenyl)silyl]-(2-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccccc1C(NS(=O)(=O)c1ccc(C)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H27NO3SSi/c1-18-14-16-19(17-15-18)28(25,26)24-23(21-12-8-9-13-22(21)27-2)29(3,4)20-10-6-5-7-11-20/h5-17,23-24H,1-4H3 |
| InChIKey | PKMAMAGVNZMRNC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|