C26H25NO4S — CID 101182507
N-[2-hydroxy-2-(2-methoxyphenyl)-1-naphthalen-2-ylethyl]-4-methylbenzenesulfonamide (PubChem CID 101182507) has the molecular formula C26H25NO4S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[2-hydroxy-2-(2-methoxyphenyl)-1-naphthalen-2-ylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-hydroxy-2-(2-methoxyphenyl)-1-naphthalen-2-ylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101182507 |
| Molecular Formula | C26H25NO4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[2-hydroxy-2-(2-methoxyphenyl)-1-naphthalen-2-ylethyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccccc1C(O)C(NS(=O)(=O)c1ccc(C)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H25NO4S/c1-18-11-15-22(16-12-18)32(29,30)27-25(26(28)23-9-5-6-10-24(23)31-2)21-14-13-19-7-3-4-8-20(19)17-21/h3-17,25-28H,1-2H3 |
| InChIKey | UQLMAFUFTSWOIA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |