C26H22N2O6S — CID 135065452
(4-nitrophenyl) (3S)-3-[(4-methylphenyl)sulfonylamino]-3-naphthalen-2-ylpropanoate (PubChem CID 135065452) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is (4-nitrophenyl) (3S)-3-[(4-methylphenyl)sulfonylamino]-3-naphthalen-2-ylpropanoate.
| Compound Name | (4-nitrophenyl) (3S)-3-[(4-methylphenyl)sulfonylamino]-3-naphthalen-2-ylpropanoate |
|---|---|
| PubChem CID | 135065452 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | (4-nitrophenyl) (3S)-3-[(4-methylphenyl)sulfonylamino]-3-naphthalen-2-ylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)Oc2ccc([N+](=O)[O-])cc2)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C26H22N2O6S/c1-18-6-14-24(15-7-18)35(32,33)27-25(21-9-8-19-4-2-3-5-20(19)16-21)17-26(29)34-23-12-10-22(11-13-23)28(30)31/h2-16,25,27H,17H2,1H3/t25-/m0/s1 |
| InChIKey | NJYXCIMYNIJSKA-VWLOTQADSA-N |
| XLogP | 5.07 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|