C24H21ClN2O5S — CID 45379252
N-[(E)-5-(4-chlorophenyl)-1-(4-nitrophenyl)-3-oxopent-4-enyl]-4-methylbenzenesulfonamide (PubChem CID 45379252) has the molecular formula C24H21ClN2O5S and a molecular weight of 484.96 g/mol. Its IUPAC name is N-[(E)-5-(4-chlorophenyl)-1-(4-nitrophenyl)-3-oxopent-4-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-5-(4-chlorophenyl)-1-(4-nitrophenyl)-3-oxopent-4-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 45379252 |
| Molecular Formula | C24H21ClN2O5S |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-[(E)-5-(4-chlorophenyl)-1-(4-nitrophenyl)-3-oxopent-4-enyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CC(=O)/C=C/c2ccc(Cl)cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H21ClN2O5S/c1-17-2-14-23(15-3-17)33(31,32)26-24(19-7-11-21(12-8-19)27(29)30)16-22(28)13-6-18-4-9-20(25)10-5-18/h2-15,24,26H,16H2,1H3/b13-6+ |
| InChIKey | LVLWXXDTEHXOFM-AWNIVKPZSA-N |
| XLogP | 5.25 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|