C22H19ClN2O6S — CID 139224229
[2-(3-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]ethyl] 4-nitrobenzoate (PubChem CID 139224229) has the molecular formula C22H19ClN2O6S and a molecular weight of 474.92 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]ethyl] 4-nitrobenzoate.
| Compound Name | [2-(3-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]ethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 139224229 |
| Molecular Formula | C22H19ClN2O6S |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | [2-(3-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]ethyl] 4-nitrobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(COC(=O)c2ccc([N+](=O)[O-])cc2)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H19ClN2O6S/c1-15-5-11-20(12-6-15)32(29,30)24-21(17-3-2-4-18(23)13-17)14-31-22(26)16-7-9-19(10-8-16)25(27)28/h2-13,21,24H,14H2,1H3 |
| InChIKey | YOXIXOLSESCZSJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|