C18H17ClNO6S- — CID 2400773
(3S)-3-(2-chlorophenyl)-3-[(4-ethoxycarbonylphenyl)sulfonylamino]propanoate (PubChem CID 2400773) has the molecular formula C18H17ClNO6S- and a molecular weight of 410.86 g/mol. Its IUPAC name is (3S)-3-(2-chlorophenyl)-3-[(4-ethoxycarbonylphenyl)sulfonylamino]propanoate.
| Compound Name | (3S)-3-(2-chlorophenyl)-3-[(4-ethoxycarbonylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 2400773 |
| Molecular Formula | C18H17ClNO6S- |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (3S)-3-(2-chlorophenyl)-3-[(4-ethoxycarbonylphenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N[C@@H](CC(=O)[O-])c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO6S/c1-2-26-18(23)12-7-9-13(10-8-12)27(24,25)20-16(11-17(21)22)14-5-3-4-6-15(14)19/h3-10,16,20H,2,11H2,1H3,(H,21,22)/p-1/t16-/m0/s1 |
| InChIKey | RRPHWCFWBWPEBC-INIZCTEOSA-M |
| XLogP | 1.68 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |