C26H23N3O8S — CID 102434652
[(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]-5-phenylpenta-3,4-dienyl] 3,5-dinitrobenzoate (PubChem CID 102434652) has the molecular formula C26H23N3O8S and a molecular weight of 537.55 g/mol. Its IUPAC name is [(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]-5-phenylpenta-3,4-dienyl] 3,5-dinitrobenzoate.
| Compound Name | [(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]-5-phenylpenta-3,4-dienyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 102434652 |
| Molecular Formula | C26H23N3O8S |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | [(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]-5-phenylpenta-3,4-dienyl] 3,5-dinitrobenzoate |
| SMILES | CC(=C=Cc1ccccc1)[C@@H](COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H23N3O8S/c1-18-8-12-24(13-9-18)38(35,36)27-25(19(2)10-11-20-6-4-3-5-7-20)17-37-26(30)21-14-22(28(31)32)16-23(15-21)29(33)34/h3-9,11-16,25,27H,17H2,1-2H3/t10?,25-/m1/s1 |
| InChIKey | GQDXBROQFROAOV-HYUNLGGNSA-N |
| XLogP | 4.57 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|