C30H24ClN5O8S — CID 99650907
N-[(2S)-1-[(3R)-3-(2-chlorophenyl)-2-(3,5-dinitrobenzoyl)diaziridin-1-yl]-1-oxo-3-phenylpropan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 99650907) has the molecular formula C30H24ClN5O8S and a molecular weight of 650.07 g/mol. Its IUPAC name is N-[(2S)-1-[(3R)-3-(2-chlorophenyl)-2-(3,5-dinitrobenzoyl)diaziridin-1-yl]-1-oxo-3-phenylpropan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-1-[(3R)-3-(2-chlorophenyl)-2-(3,5-dinitrobenzoyl)diaziridin-1-yl]-1-oxo-3-phenylpropan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 99650907 |
| Molecular Formula | C30H24ClN5O8S |
| Molecular Weight | 650.07 g/mol |
| Exact Mass | 649.10 |
| IUPAC Name | N-[(2S)-1-[(3R)-3-(2-chlorophenyl)-2-(3,5-dinitrobenzoyl)diaziridin-1-yl]-1-oxo-3-phenylpropan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)N2[C@H](c3ccccc3Cl)N2C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C30H24ClN5O8S/c1-19-11-13-24(14-12-19)45(43,44)32-27(15-20-7-3-2-4-8-20)30(38)34-28(25-9-5-6-10-26(25)31)33(34)29(37)21-16-22(35(39)40)18-23(17-21)36(41)42/h2-14,16-18,27-28,32H,15H2,1H3/t27-,28+,33?,34?/m0/s1 |
| InChIKey | FONOFPPMMCHDKW-IOMRGGENSA-N |
| XLogP | 4.95 |
| TPSA | 172.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.07 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|