C31H36N4O7S — CID 45489165
4-methyl-N-[1-[4-[1-(5-nitrofuran-2-carbonyl)piperidin-4-yl]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]benzenesulfonamide (PubChem CID 45489165) has the molecular formula C31H36N4O7S and a molecular weight of 608.72 g/mol. Its IUPAC name is 4-methyl-N-[1-[4-[1-(5-nitrofuran-2-carbonyl)piperidin-4-yl]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-[4-[1-(5-nitrofuran-2-carbonyl)piperidin-4-yl]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 45489165 |
| Molecular Formula | C31H36N4O7S |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | 4-methyl-N-[1-[4-[1-(5-nitrofuran-2-carbonyl)piperidin-4-yl]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)N2CCC(C3CCN(C(=O)c4ccc([N+](=O)[O-])o4)CC3)CC2)cc1 |
| InChI | InChI=1S/C31H36N4O7S/c1-22-7-9-26(10-8-22)43(40,41)32-27(21-23-5-3-2-4-6-23)30(36)33-17-13-24(14-18-33)25-15-19-34(20-16-25)31(37)28-11-12-29(42-28)35(38)39/h2-12,24-25,27,32H,13-21H2,1H3 |
| InChIKey | WZHCIDXVUPKZMT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 143.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|