About 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate
3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate (PubChem CID 161093279) has the molecular formula C28H24N2O5
and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate.
Molecular Properties
| Compound Name | 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate |
| PubChem CID | 161093279 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)cc([N+](=O)[O-])c1.Nc1cc(C=O)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H13NO4.C13H11NO/c1-2-20-15(17)13-8-12(9-14(10-13)16(18)19)11-6-4-3-5-7-11;14-13-7-10(9-15)6-12(8-13)11-4-2-1-3-5-11/h3-10H,2H2,1H3;1-9H,14H2 |
| InChIKey | UHLQBGWVXHTCOP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate?
The IUPAC name of 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate (CID 161093279) is 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate.
What is the SMILES notation for 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate?
The canonical SMILES for 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate is CCOC(=O)c1cc(-c2ccccc2)cc([N+](=O)[O-])c1.Nc1cc(C=O)cc(-c2ccccc2)c1.
What is the InChIKey of 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate?
The InChIKey is UHLQBGWVXHTCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4.C13H11NO/c1-2-20-15(17)13-8-12(9-14(10-13)16(18)19)11-6-4-3-5-7-11;14-13-7-10(9-15)6-12(8-13)11-4-2-1-3-5-11/h3-10H,2H2,1H3;1-9H,14H2.
What are the key properties of 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate?
3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate has a molecular weight of 468.51 g/mol, XLogP of 6.19, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-phenylbenzaldehyde;ethyl 3-nitro-5-phenylbenzoate is sourced from PubChem (CID 161093279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).