C25H22N2O7 — CID 41198475
3-O-[2-(N-benzylanilino)-2-oxoethyl] 1-O-ethyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 41198475) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is 3-O-[2-(N-benzylanilino)-2-oxoethyl] 1-O-ethyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[2-(N-benzylanilino)-2-oxoethyl] 1-O-ethyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 41198475 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 3-O-[2-(N-benzylanilino)-2-oxoethyl] 1-O-ethyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC(=O)N(Cc2ccccc2)c2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22N2O7/c1-2-33-24(29)19-13-20(15-22(14-19)27(31)32)25(30)34-17-23(28)26(21-11-7-4-8-12-21)16-18-9-5-3-6-10-18/h3-15H,2,16-17H2,1H3 |
| InChIKey | LVEREBNHDAXJSF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|