C15H21NO2S — CID 100946178
4-methyl-N-[(5E)-4-methylhepta-1,5-dien-3-yl]benzenesulfonamide (PubChem CID 100946178) has the molecular formula C15H21NO2S and a molecular weight of 279.41 g/mol. Its IUPAC name is 4-methyl-N-[(5E)-4-methylhepta-1,5-dien-3-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(5E)-4-methylhepta-1,5-dien-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 100946178 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-methyl-N-[(5E)-4-methylhepta-1,5-dien-3-yl]benzenesulfonamide |
| SMILES | C=CC(NS(=O)(=O)c1ccc(C)cc1)C(C)/C=C/C |
| InChI | InChI=1S/C15H21NO2S/c1-5-7-13(4)15(6-2)16-19(17,18)14-10-8-12(3)9-11-14/h5-11,13,15-16H,2H2,1,3-4H3/b7-5+ |
| InChIKey | TYLUUVHHSPJDTQ-FNORWQNLSA-N |
| XLogP | 3.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|