C19H27NO3S — CID 143418576
ethane;4-methyl-N-[(4E)-2-oxo-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]benzenesulfonamide (PubChem CID 143418576) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is ethane;4-methyl-N-[(4E)-2-oxo-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]benzenesulfonamide.
| Compound Name | ethane;4-methyl-N-[(4E)-2-oxo-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 143418576 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | ethane;4-methyl-N-[(4E)-2-oxo-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]benzenesulfonamide |
| SMILES | C=C/C=C(\C=C/C)C(NS(=O)(=O)c1ccc(C)cc1)C(C)=O.CC |
| InChI | InChI=1S/C17H21NO3S.C2H6/c1-5-7-15(8-6-2)17(14(4)19)18-22(20,21)16-11-9-13(3)10-12-16;1-2/h5-12,17-18H,1H2,2-4H3;1-2H3/b8-6-,15-7+; |
| InChIKey | FYZLTIFONMFJIS-MMWRLFOHSA-N |
| XLogP | 3.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|