C16H23NO2S — CID 25016898
4-methyl-N-nona-1,8-dien-5-ylbenzenesulfonamide (PubChem CID 25016898) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 4-methyl-N-nona-1,8-dien-5-ylbenzenesulfonamide.
| Compound Name | 4-methyl-N-nona-1,8-dien-5-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 25016898 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-methyl-N-nona-1,8-dien-5-ylbenzenesulfonamide |
| SMILES | C=CCCC(CCC=C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H23NO2S/c1-4-6-8-15(9-7-5-2)17-20(18,19)16-12-10-14(3)11-13-16/h4-5,10-13,15,17H,1-2,6-9H2,3H3 |
| InChIKey | HYFGTVLGHIOYDS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|