C14H23NO5SSi — CID 68854810
4-methyl-N-(1-trimethoxysilylbut-3-enyl)benzenesulfonamide (PubChem CID 68854810) has the molecular formula C14H23NO5SSi and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-methyl-N-(1-trimethoxysilylbut-3-enyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(1-trimethoxysilylbut-3-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 68854810 |
| Molecular Formula | C14H23NO5SSi |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-methyl-N-(1-trimethoxysilylbut-3-enyl)benzenesulfonamide |
| SMILES | C=CCC(NS(=O)(=O)c1ccc(C)cc1)[Si](OC)(OC)OC |
| InChI | InChI=1S/C14H23NO5SSi/c1-6-7-14(22(18-3,19-4)20-5)15-21(16,17)13-10-8-12(2)9-11-13/h6,8-11,14-15H,1,7H2,2-5H3 |
| InChIKey | UQXZXLQPFXFYEY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|