C20H35NO3SSi — CID 10715848
N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pent-4-enyl]-4-methylbenzenesulfonamide (PubChem CID 10715848) has the molecular formula C20H35NO3SSi and a molecular weight of 397.66 g/mol. Its IUPAC name is N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pent-4-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pent-4-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10715848 |
| Molecular Formula | C20H35NO3SSi |
| Molecular Weight | 397.66 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pent-4-enyl]-4-methylbenzenesulfonamide |
| SMILES | C=CCC(CCO[Si](C)(C)C(C)(C)C)CNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H35NO3SSi/c1-8-9-18(14-15-24-26(6,7)20(3,4)5)16-21-25(22,23)19-12-10-17(2)11-13-19/h8,10-13,18,21H,1,9,14-16H2,2-7H3 |
| InChIKey | IJISWFDTEHWICU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|