C13H19NO4S — CID 71419925
N-(2-hydroxy-3-prop-2-enoxypropyl)-4-methylbenzenesulfonamide (PubChem CID 71419925) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is N-(2-hydroxy-3-prop-2-enoxypropyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2-hydroxy-3-prop-2-enoxypropyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71419925 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(2-hydroxy-3-prop-2-enoxypropyl)-4-methylbenzenesulfonamide |
| SMILES | C=CCOCC(O)CNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-3-8-18-10-12(15)9-14-19(16,17)13-6-4-11(2)5-7-13/h3-7,12,14-15H,1,8-10H2,2H3 |
| InChIKey | NWBLUGAQWJEZQP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|