C15H22N2O4S — CID 94782590
(2R)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-prop-2-enoxypropanamide (PubChem CID 94782590) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is (2R)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-prop-2-enoxypropanamide.
| Compound Name | (2R)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-prop-2-enoxypropanamide |
|---|---|
| PubChem CID | 94782590 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2R)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-2-prop-2-enoxypropanamide |
| SMILES | C=CCO[C@H](C)C(=O)NCCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H22N2O4S/c1-4-11-21-13(3)15(18)16-9-10-17-22(19,20)14-7-5-12(2)6-8-14/h4-8,13,17H,1,9-11H2,2-3H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | XYDMDOJCYHJOCQ-CYBMUJFWSA-N |
| XLogP | 0.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|