C17H22N2O6S — CID 102087105
prop-2-enyl (2S)-3-[(4-methylphenyl)sulfonylamino]-2-(prop-2-enoxycarbonylamino)propanoate (PubChem CID 102087105) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-[(4-methylphenyl)sulfonylamino]-2-(prop-2-enoxycarbonylamino)propanoate.
| Compound Name | prop-2-enyl (2S)-3-[(4-methylphenyl)sulfonylamino]-2-(prop-2-enoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 102087105 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | prop-2-enyl (2S)-3-[(4-methylphenyl)sulfonylamino]-2-(prop-2-enoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)N[C@@H](CNS(=O)(=O)c1ccc(C)cc1)C(=O)OCC=C |
| InChI | InChI=1S/C17H22N2O6S/c1-4-10-24-16(20)15(19-17(21)25-11-5-2)12-18-26(22,23)14-8-6-13(3)7-9-14/h4-9,15,18H,1-2,10-12H2,3H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | ZTEIIIDIMNMXKJ-HNNXBMFYSA-N |
| XLogP | 1.28 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|