C21H24BrNO4S — CID 163919873
[(Z)-but-2-enyl] 2-[(4-bromophenyl)methyl]-3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 163919873) has the molecular formula C21H24BrNO4S and a molecular weight of 466.40 g/mol. Its IUPAC name is [(Z)-but-2-enyl] 2-[(4-bromophenyl)methyl]-3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | [(Z)-but-2-enyl] 2-[(4-bromophenyl)methyl]-3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 163919873 |
| Molecular Formula | C21H24BrNO4S |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | [(Z)-but-2-enyl] 2-[(4-bromophenyl)methyl]-3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | C/C=C\COC(=O)C(CNS(=O)(=O)c1ccc(C)cc1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H24BrNO4S/c1-3-4-13-27-21(24)18(14-17-7-9-19(22)10-8-17)15-23-28(25,26)20-11-5-16(2)6-12-20/h3-12,18,23H,13-15H2,1-2H3/b4-3- |
| InChIKey | QZMVHNUUAGADHT-ARJAWSKDSA-N |
| XLogP | 4.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|