C10H11Br2NO4S — CID 103493729
methyl 2-bromo-3-[(4-bromophenyl)sulfonylamino]propanoate (PubChem CID 103493729) has the molecular formula C10H11Br2NO4S and a molecular weight of 401.08 g/mol. Its IUPAC name is methyl 2-bromo-3-[(4-bromophenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-bromo-3-[(4-bromophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 103493729 |
| Molecular Formula | C10H11Br2NO4S |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.88 |
| IUPAC Name | methyl 2-bromo-3-[(4-bromophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(Br)CNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H11Br2NO4S/c1-17-10(14)9(12)6-13-18(15,16)8-4-2-7(11)3-5-8/h2-5,9,13H,6H2,1H3 |
| InChIKey | ZAIGBWZHEVEDFR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|