C11H15NO7S2 — CID 103878746
methyl 2-hydroxy-3-[(4-methylsulfonylphenyl)sulfonylamino]propanoate (PubChem CID 103878746) has the molecular formula C11H15NO7S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(4-methylsulfonylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[(4-methylsulfonylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 103878746 |
| Molecular Formula | C11H15NO7S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | methyl 2-hydroxy-3-[(4-methylsulfonylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(O)CNS(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H15NO7S2/c1-19-11(14)10(13)7-12-21(17,18)9-5-3-8(4-6-9)20(2,15)16/h3-6,10,12-13H,7H2,1-2H3 |
| InChIKey | WZJUHBCSTYFSGE-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |