C14H19NO4S — CID 55475988
[(E)-but-2-enyl] 3-[4-(methylsulfamoyl)phenyl]propanoate (PubChem CID 55475988) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is [(E)-but-2-enyl] 3-[4-(methylsulfamoyl)phenyl]propanoate.
| Compound Name | [(E)-but-2-enyl] 3-[4-(methylsulfamoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 55475988 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [(E)-but-2-enyl] 3-[4-(methylsulfamoyl)phenyl]propanoate |
| SMILES | C/C=C/COC(=O)CCc1ccc(S(=O)(=O)NC)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-3-4-11-19-14(16)10-7-12-5-8-13(9-6-12)20(17,18)15-2/h3-6,8-9,15H,7,10-11H2,1-2H3/b4-3+ |
| InChIKey | OFCXBGAXLHCCOV-ONEGZZNKSA-N |
| XLogP | 1.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|