C26H28N2O5S — CID 55375109
[2-(1,2-diphenylethylamino)-2-oxoethyl] 3-[4-(methylsulfamoyl)phenyl]propanoate (PubChem CID 55375109) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is [2-(1,2-diphenylethylamino)-2-oxoethyl] 3-[4-(methylsulfamoyl)phenyl]propanoate.
| Compound Name | [2-(1,2-diphenylethylamino)-2-oxoethyl] 3-[4-(methylsulfamoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 55375109 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [2-(1,2-diphenylethylamino)-2-oxoethyl] 3-[4-(methylsulfamoyl)phenyl]propanoate |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)OCC(=O)NC(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O5S/c1-27-34(31,32)23-15-12-20(13-16-23)14-17-26(30)33-19-25(29)28-24(22-10-6-3-7-11-22)18-21-8-4-2-5-9-21/h2-13,15-16,24,27H,14,17-19H2,1H3,(H,28,29) |
| InChIKey | JRKWGKVRYLWGCJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |