C18H23NO5S2 — CID 25158928
[2-methyl-3-[(4-methylphenyl)sulfonylamino]propyl] 4-methylbenzenesulfonate (PubChem CID 25158928) has the molecular formula C18H23NO5S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is [2-methyl-3-[(4-methylphenyl)sulfonylamino]propyl] 4-methylbenzenesulfonate.
| Compound Name | [2-methyl-3-[(4-methylphenyl)sulfonylamino]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 25158928 |
| Molecular Formula | C18H23NO5S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [2-methyl-3-[(4-methylphenyl)sulfonylamino]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H23NO5S2/c1-14-4-8-17(9-5-14)25(20,21)19-12-16(3)13-24-26(22,23)18-10-6-15(2)7-11-18/h4-11,16,19H,12-13H2,1-3H3 |
| InChIKey | SQOFNVPQZDCDSH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|