C10H12Br2O3S — CID 88837197
2,3-dibromopropyl 4-methylbenzenesulfonate (PubChem CID 88837197) has the molecular formula C10H12Br2O3S and a molecular weight of 372.08 g/mol. Its IUPAC name is 2,3-dibromopropyl 4-methylbenzenesulfonate.
| Compound Name | 2,3-dibromopropyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88837197 |
| Molecular Formula | C10H12Br2O3S |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.89 |
| IUPAC Name | 2,3-dibromopropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(Br)CBr)cc1 |
| InChI | InChI=1S/C10H12Br2O3S/c1-8-2-4-10(5-3-8)16(13,14)15-7-9(12)6-11/h2-5,9H,6-7H2,1H3 |
| InChIKey | KEUCKCHYGNVPBE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|