C9H11BrO4S — CID 134933987
[(1R)-2-bromo-1-hydroxyethyl] 4-methylbenzenesulfonate (PubChem CID 134933987) has the molecular formula C9H11BrO4S and a molecular weight of 295.15 g/mol. Its IUPAC name is [(1R)-2-bromo-1-hydroxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R)-2-bromo-1-hydroxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134933987 |
| Molecular Formula | C9H11BrO4S |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | [(1R)-2-bromo-1-hydroxyethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](O)CBr)cc1 |
| InChI | InChI=1S/C9H11BrO4S/c1-7-2-4-8(5-3-7)15(12,13)14-9(11)6-10/h2-5,9,11H,6H2,1H3/t9-/m1/s1 |
| InChIKey | MPRWGCJIFDJQIV-SECBINFHSA-N |
| XLogP | 1.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|