C10H12N2O3S — CID 14656670
(2-amino-2-cyanoethyl) 4-methylbenzenesulfonate (PubChem CID 14656670) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is (2-amino-2-cyanoethyl) 4-methylbenzenesulfonate.
| Compound Name | (2-amino-2-cyanoethyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14656670 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (2-amino-2-cyanoethyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(N)C#N)cc1 |
| InChI | InChI=1S/C10H12N2O3S/c1-8-2-4-10(5-3-8)16(13,14)15-7-9(12)6-11/h2-5,9H,7,12H2,1H3 |
| InChIKey | LIGXBTOKABCULS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|