C17H22N2O6S2 — CID 121005454
[(2R)-2-amino-2-cyanoethyl] 4-methylbenzenesulfonate;4-methylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 121005454) has the molecular formula C17H22N2O6S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is [(2R)-2-amino-2-cyanoethyl] 4-methylbenzenesulfonate;4-methylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | [(2R)-2-amino-2-cyanoethyl] 4-methylbenzenesulfonate;4-methylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 121005454 |
| Molecular Formula | C17H22N2O6S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | [(2R)-2-amino-2-cyanoethyl] 4-methylbenzenesulfonate;4-methylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CC1=CCC(S(=O)(=O)O)C=C1.Cc1ccc(S(=O)(=O)OC[C@H](N)C#N)cc1 |
| InChI | InChI=1S/C10H12N2O3S.C7H10O3S/c1-8-2-4-10(5-3-8)16(13,14)15-7-9(12)6-11;1-6-2-4-7(5-3-6)11(8,9)10/h2-5,9H,7,12H2,1H3;2-4,7H,5H2,1H3,(H,8,9,10)/t9-;/m1./s1 |
| InChIKey | NWFLJOLYTMUEIB-SBSPUUFOSA-N |
| XLogP | 1.70 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|